About 4-[3,5-dichloro-6-(ethylamino)-2-pyridinyl]-3-ethylpiperazin-2-one
4-[3,5-dichloro-6-(ethylamino)-2-pyridinyl]-3-ethylpiperazin-2-one (PubChem CID 102758288) has the molecular formula C13H18Cl2N4O
and a molecular weight of 317.22 g/mol. Its IUPAC name is 4-[3,5-dichloro-6-(ethylamino)-2-pyridinyl]-3-ethylpiperazin-2-one.
Molecular Properties
| Compound Name | 4-[3,5-dichloro-6-(ethylamino)-2-pyridinyl]-3-ethylpiperazin-2-one |
| PubChem CID | 102758288 |
| Molecular Formula | C13H18Cl2N4O |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 4-[3,5-dichloro-6-(ethylamino)-2-pyridinyl]-3-ethylpiperazin-2-one |
| SMILES | CCNc1nc(N2CCNC(=O)C2CC)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H18Cl2N4O/c1-3-10-13(20)17-5-6-19(10)12-9(15)7-8(14)11(18-12)16-4-2/h7,10H,3-6H2,1-2H3,(H,16,18)(H,17,20) |
| InChIKey | PSFCQJYSUPJZQE-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[3,5-dichloro-6-(ethylamino)-2-pyridinyl]-3-ethylpiperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3,5-dichloro-6-(ethylamino)-2-pyridinyl]-3-ethylpiperazin-2-one?
The IUPAC name of 4-[3,5-dichloro-6-(ethylamino)-2-pyridinyl]-3-ethylpiperazin-2-one (CID 102758288) is 4-[3,5-dichloro-6-(ethylamino)-2-pyridinyl]-3-ethylpiperazin-2-one.
What is the SMILES notation for 4-[3,5-dichloro-6-(ethylamino)-2-pyridinyl]-3-ethylpiperazin-2-one?
The canonical SMILES for 4-[3,5-dichloro-6-(ethylamino)-2-pyridinyl]-3-ethylpiperazin-2-one is CCNc1nc(N2CCNC(=O)C2CC)c(Cl)cc1Cl.
What is the InChIKey of 4-[3,5-dichloro-6-(ethylamino)-2-pyridinyl]-3-ethylpiperazin-2-one?
The InChIKey is PSFCQJYSUPJZQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18Cl2N4O/c1-3-10-13(20)17-5-6-19(10)12-9(15)7-8(14)11(18-12)16-4-2/h7,10H,3-6H2,1-2H3,(H,16,18)(H,17,20).
What are the key properties of 4-[3,5-dichloro-6-(ethylamino)-2-pyridinyl]-3-ethylpiperazin-2-one?
4-[3,5-dichloro-6-(ethylamino)-2-pyridinyl]-3-ethylpiperazin-2-one has a molecular weight of 317.22 g/mol, XLogP of 2.54, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3,5-dichloro-6-(ethylamino)-2-pyridinyl]-3-ethylpiperazin-2-one is sourced from PubChem (CID 102758288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).