C12H14Cl2N4O2 — CID 102758853
4-[3,5-dichloro-6-(propylamino)-2-pyridinyl]piperazine-2,6-dione (PubChem CID 102758853) has the molecular formula C12H14Cl2N4O2 and a molecular weight of 317.18 g/mol. Its IUPAC name is 4-[3,5-dichloro-6-(propylamino)-2-pyridinyl]piperazine-2,6-dione.
| Compound Name | 4-[3,5-dichloro-6-(propylamino)-2-pyridinyl]piperazine-2,6-dione |
|---|---|
| PubChem CID | 102758853 |
| Molecular Formula | C12H14Cl2N4O2 |
| Molecular Weight | 317.18 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 4-[3,5-dichloro-6-(propylamino)-2-pyridinyl]piperazine-2,6-dione |
| SMILES | CCCNc1nc(N2CC(=O)NC(=O)C2)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H14Cl2N4O2/c1-2-3-15-11-7(13)4-8(14)12(17-11)18-5-9(19)16-10(20)6-18/h4H,2-3,5-6H2,1H3,(H,15,17)(H,16,19,20) |
| InChIKey | IXXMQKNOBOZALX-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.18 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|