C11H12Cl2N4O2 — CID 102758858
4-(6-amino-3,5-dichloro-2-pyridinyl)-3,3-dimethylpiperazine-2,6-dione (PubChem CID 102758858) has the molecular formula C11H12Cl2N4O2 and a molecular weight of 303.15 g/mol. Its IUPAC name is 4-(6-amino-3,5-dichloro-2-pyridinyl)-3,3-dimethylpiperazine-2,6-dione.
| Compound Name | 4-(6-amino-3,5-dichloro-2-pyridinyl)-3,3-dimethylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 102758858 |
| Molecular Formula | C11H12Cl2N4O2 |
| Molecular Weight | 303.15 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | 4-(6-amino-3,5-dichloro-2-pyridinyl)-3,3-dimethylpiperazine-2,6-dione |
| SMILES | CC1(C)C(=O)NC(=O)CN1c1nc(N)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H12Cl2N4O2/c1-11(2)10(19)15-7(18)4-17(11)9-6(13)3-5(12)8(14)16-9/h3H,4H2,1-2H3,(H2,14,16)(H,15,18,19) |
| InChIKey | ORBNEXSHQDIWAB-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.15 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|