C13H13F3N2OS — CID 102759066
(4-ethylthiadiazol-5-yl)-[2-methyl-4-(trifluoromethyl)phenyl]methanol (PubChem CID 102759066) has the molecular formula C13H13F3N2OS and a molecular weight of 302.32 g/mol. Its IUPAC name is (4-ethylthiadiazol-5-yl)-[2-methyl-4-(trifluoromethyl)phenyl]methanol.
| Compound Name | (4-ethylthiadiazol-5-yl)-[2-methyl-4-(trifluoromethyl)phenyl]methanol |
|---|---|
| PubChem CID | 102759066 |
| Molecular Formula | C13H13F3N2OS |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | (4-ethylthiadiazol-5-yl)-[2-methyl-4-(trifluoromethyl)phenyl]methanol |
| SMILES | CCc1nnsc1C(O)c1ccc(C(F)(F)F)cc1C |
| InChI | InChI=1S/C13H13F3N2OS/c1-3-10-12(20-18-17-10)11(19)9-5-4-8(6-7(9)2)13(14,15)16/h4-6,11,19H,3H2,1-2H3 |
| InChIKey | BYPVOEFNDAHPSZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |