About 6-but-3-enoxy-3,5-dichloropyridin-2-amine
6-but-3-enoxy-3,5-dichloropyridin-2-amine (PubChem CID 102760392) has the molecular formula C9H10Cl2N2O
and a molecular weight of 233.10 g/mol. Its IUPAC name is 6-but-3-enoxy-3,5-dichloropyridin-2-amine.
Molecular Properties
| Compound Name | 6-but-3-enoxy-3,5-dichloropyridin-2-amine |
| PubChem CID | 102760392 |
| Molecular Formula | C9H10Cl2N2O |
| Molecular Weight | 233.10 g/mol |
| Exact Mass | 232.02 |
| IUPAC Name | 6-but-3-enoxy-3,5-dichloropyridin-2-amine |
| SMILES | C=CCCOc1nc(N)c(Cl)cc1Cl |
| InChI | InChI=1S/C9H10Cl2N2O/c1-2-3-4-14-9-7(11)5-6(10)8(12)13-9/h2,5H,1,3-4H2,(H2,12,13) |
| InChIKey | KOCKIYXVOCPAHU-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.10 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-but-3-enoxy-3,5-dichloropyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-but-3-enoxy-3,5-dichloropyridin-2-amine?
The IUPAC name of 6-but-3-enoxy-3,5-dichloropyridin-2-amine (CID 102760392) is 6-but-3-enoxy-3,5-dichloropyridin-2-amine.
What is the SMILES notation for 6-but-3-enoxy-3,5-dichloropyridin-2-amine?
The canonical SMILES for 6-but-3-enoxy-3,5-dichloropyridin-2-amine is C=CCCOc1nc(N)c(Cl)cc1Cl.
What is the InChIKey of 6-but-3-enoxy-3,5-dichloropyridin-2-amine?
The InChIKey is KOCKIYXVOCPAHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10Cl2N2O/c1-2-3-4-14-9-7(11)5-6(10)8(12)13-9/h2,5H,1,3-4H2,(H2,12,13).
What are the key properties of 6-but-3-enoxy-3,5-dichloropyridin-2-amine?
6-but-3-enoxy-3,5-dichloropyridin-2-amine has a molecular weight of 233.10 g/mol, XLogP of 2.93, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-but-3-enoxy-3,5-dichloropyridin-2-amine is sourced from PubChem (CID 102760392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).