C7H5Cl2F3N2O — CID 102760405
3,5-dichloro-6-(2,2,2-trifluoroethoxy)pyridin-2-amine (PubChem CID 102760405) has the molecular formula C7H5Cl2F3N2O and a molecular weight of 261.03 g/mol. Its IUPAC name is 3,5-dichloro-6-(2,2,2-trifluoroethoxy)pyridin-2-amine.
| Compound Name | 3,5-dichloro-6-(2,2,2-trifluoroethoxy)pyridin-2-amine |
|---|---|
| PubChem CID | 102760405 |
| Molecular Formula | C7H5Cl2F3N2O |
| Molecular Weight | 261.03 g/mol |
| Exact Mass | 259.97 |
| IUPAC Name | 3,5-dichloro-6-(2,2,2-trifluoroethoxy)pyridin-2-amine |
| SMILES | Nc1nc(OCC(F)(F)F)c(Cl)cc1Cl |
| InChI | InChI=1S/C7H5Cl2F3N2O/c8-3-1-4(9)6(14-5(3)13)15-2-7(10,11)12/h1H,2H2,(H2,13,14) |
| InChIKey | TVMCWBRANPLSSZ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.03 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |