C26H24N4O4 — CID 10276079
ethyl 4-[[4,6-bis(4-methoxyphenyl)-1,3,5-triazin-2-yl]amino]benzoate (PubChem CID 10276079) has the molecular formula C26H24N4O4 and a molecular weight of 456.50 g/mol. Its IUPAC name is ethyl 4-[[4,6-bis(4-methoxyphenyl)-1,3,5-triazin-2-yl]amino]benzoate.
| Compound Name | ethyl 4-[[4,6-bis(4-methoxyphenyl)-1,3,5-triazin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 10276079 |
| Molecular Formula | C26H24N4O4 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | ethyl 4-[[4,6-bis(4-methoxyphenyl)-1,3,5-triazin-2-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2nc(-c3ccc(OC)cc3)nc(-c3ccc(OC)cc3)n2)cc1 |
| InChI | InChI=1S/C26H24N4O4/c1-4-34-25(31)19-5-11-20(12-6-19)27-26-29-23(17-7-13-21(32-2)14-8-17)28-24(30-26)18-9-15-22(33-3)16-10-18/h5-16H,4H2,1-3H3,(H,27,28,29,30) |
| InChIKey | XZFMMEDMDMDRJJ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 95.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |