About 4-[(6-amino-3,5-dichloro-2-pyridinyl)oxy]-3,5-dimethylbenzonitrile
4-[(6-amino-3,5-dichloro-2-pyridinyl)oxy]-3,5-dimethylbenzonitrile (PubChem CID 102760990) has the molecular formula C14H11Cl2N3O
and a molecular weight of 308.17 g/mol. Its IUPAC name is 4-[(6-amino-3,5-dichloro-2-pyridinyl)oxy]-3,5-dimethylbenzonitrile.
Molecular Properties
| Compound Name | 4-[(6-amino-3,5-dichloro-2-pyridinyl)oxy]-3,5-dimethylbenzonitrile |
| PubChem CID | 102760990 |
| Molecular Formula | C14H11Cl2N3O |
| Molecular Weight | 308.17 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | 4-[(6-amino-3,5-dichloro-2-pyridinyl)oxy]-3,5-dimethylbenzonitrile |
| SMILES | Cc1cc(C#N)cc(C)c1Oc1nc(N)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H11Cl2N3O/c1-7-3-9(6-17)4-8(2)12(7)20-14-11(16)5-10(15)13(18)19-14/h3-5H,1-2H3,(H2,18,19) |
| InChIKey | RGRRQGFFUVAEOR-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.17 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(6-amino-3,5-dichloro-2-pyridinyl)oxy]-3,5-dimethylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(6-amino-3,5-dichloro-2-pyridinyl)oxy]-3,5-dimethylbenzonitrile?
The IUPAC name of 4-[(6-amino-3,5-dichloro-2-pyridinyl)oxy]-3,5-dimethylbenzonitrile (CID 102760990) is 4-[(6-amino-3,5-dichloro-2-pyridinyl)oxy]-3,5-dimethylbenzonitrile.
What is the SMILES notation for 4-[(6-amino-3,5-dichloro-2-pyridinyl)oxy]-3,5-dimethylbenzonitrile?
The canonical SMILES for 4-[(6-amino-3,5-dichloro-2-pyridinyl)oxy]-3,5-dimethylbenzonitrile is Cc1cc(C#N)cc(C)c1Oc1nc(N)c(Cl)cc1Cl.
What is the InChIKey of 4-[(6-amino-3,5-dichloro-2-pyridinyl)oxy]-3,5-dimethylbenzonitrile?
The InChIKey is RGRRQGFFUVAEOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11Cl2N3O/c1-7-3-9(6-17)4-8(2)12(7)20-14-11(16)5-10(15)13(18)19-14/h3-5H,1-2H3,(H2,18,19).
What are the key properties of 4-[(6-amino-3,5-dichloro-2-pyridinyl)oxy]-3,5-dimethylbenzonitrile?
4-[(6-amino-3,5-dichloro-2-pyridinyl)oxy]-3,5-dimethylbenzonitrile has a molecular weight of 308.17 g/mol, XLogP of 4.25, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(6-amino-3,5-dichloro-2-pyridinyl)oxy]-3,5-dimethylbenzonitrile is sourced from PubChem (CID 102760990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).