C12H18Cl2N4 — CID 102761732
[3,5-dichloro-6-(4-ethylpiperidin-1-yl)-2-pyridinyl]hydrazine (PubChem CID 102761732) has the molecular formula C12H18Cl2N4 and a molecular weight of 289.21 g/mol. Its IUPAC name is [3,5-dichloro-6-(4-ethylpiperidin-1-yl)-2-pyridinyl]hydrazine.
| Compound Name | [3,5-dichloro-6-(4-ethylpiperidin-1-yl)-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 102761732 |
| Molecular Formula | C12H18Cl2N4 |
| Molecular Weight | 289.21 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | [3,5-dichloro-6-(4-ethylpiperidin-1-yl)-2-pyridinyl]hydrazine |
| SMILES | CCC1CCN(c2nc(NN)c(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C12H18Cl2N4/c1-2-8-3-5-18(6-4-8)12-10(14)7-9(13)11(16-12)17-15/h7-8H,2-6,15H2,1H3,(H,16,17) |
| InChIKey | MHTSTBSMFHZESI-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.21 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|