C11H19Cl2N5 — CID 102761814
3-N-(3,5-dichloro-6-hydrazinyl-2-pyridinyl)-1-N,1-N-dimethylbutane-1,3-diamine (PubChem CID 102761814) has the molecular formula C11H19Cl2N5 and a molecular weight of 292.21 g/mol. Its IUPAC name is 3-N-(3,5-dichloro-6-hydrazinyl-2-pyridinyl)-1-N,1-N-dimethylbutane-1,3-diamine.
| Compound Name | 3-N-(3,5-dichloro-6-hydrazinyl-2-pyridinyl)-1-N,1-N-dimethylbutane-1,3-diamine |
|---|---|
| PubChem CID | 102761814 |
| Molecular Formula | C11H19Cl2N5 |
| Molecular Weight | 292.21 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 3-N-(3,5-dichloro-6-hydrazinyl-2-pyridinyl)-1-N,1-N-dimethylbutane-1,3-diamine |
| SMILES | CC(CCN(C)C)Nc1nc(NN)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H19Cl2N5/c1-7(4-5-18(2)3)15-10-8(12)6-9(13)11(16-10)17-14/h6-7H,4-5,14H2,1-3H3,(H2,15,16,17) |
| InChIKey | FSMBQUXHAQUZGE-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 66.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.21 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|