C21H16ClIN2 — CID 10276248
16-chloro-8,20-dimethyl-8-aza-20-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2,4,6,9,11,13,15,17,19-decaene iodide (PubChem CID 10276248) has the molecular formula C21H16ClIN2 and a molecular weight of 458.73 g/mol. Its IUPAC name is 16-chloro-8,20-dimethyl-8-aza-20-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2,4,6,9,11,13,15,17,19-decaene iodide.
| Compound Name | 16-chloro-8,20-dimethyl-8-aza-20-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2,4,6,9,11,13,15,17,19-decaene iodide |
|---|---|
| PubChem CID | 10276248 |
| Molecular Formula | C21H16ClIN2 |
| Molecular Weight | 458.73 g/mol |
| Exact Mass | 458.00 |
| IUPAC Name | 16-chloro-8,20-dimethyl-8-aza-20-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2,4,6,9,11,13,15,17,19-decaene iodide |
| SMILES | CN1c2ccccc2-c2c3c1cccc3c1cc(Cl)ccc1[n+]2C.[I-] |
| InChI | InChI=1S/C21H16ClN2.HI/c1-23-17-8-4-3-6-15(17)21-20-14(7-5-9-19(20)23)16-12-13(22)10-11-18(16)24(21)2;/h3-12H,1-2H3;1H/q+1;/p-1 |
| InChIKey | MYMTWQCKKSSFFD-UHFFFAOYSA-M |
| XLogP | 2.22 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.73 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|