C12H10Cl2N4O3 — CID 102762949
[3,5-dichloro-6-(2-methyl-5-nitrophenoxy)-2-pyridinyl]hydrazine (PubChem CID 102762949) has the molecular formula C12H10Cl2N4O3 and a molecular weight of 329.14 g/mol. Its IUPAC name is [3,5-dichloro-6-(2-methyl-5-nitrophenoxy)-2-pyridinyl]hydrazine.
| Compound Name | [3,5-dichloro-6-(2-methyl-5-nitrophenoxy)-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 102762949 |
| Molecular Formula | C12H10Cl2N4O3 |
| Molecular Weight | 329.14 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | [3,5-dichloro-6-(2-methyl-5-nitrophenoxy)-2-pyridinyl]hydrazine |
| SMILES | Cc1ccc([N+](=O)[O-])cc1Oc1nc(NN)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H10Cl2N4O3/c1-6-2-3-7(18(19)20)4-10(6)21-12-9(14)5-8(13)11(16-12)17-15/h2-5H,15H2,1H3,(H,16,17) |
| InChIKey | GXJDVIXRGXKXJB-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 103.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.14 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|