C13H12ClF2NOS — CID 102763534
(5-chloro-4-methylthiophen-2-yl)-[4-(difluoromethoxy)phenyl]methanamine (PubChem CID 102763534) has the molecular formula C13H12ClF2NOS and a molecular weight of 303.76 g/mol. Its IUPAC name is (5-chloro-4-methylthiophen-2-yl)-[4-(difluoromethoxy)phenyl]methanamine.
| Compound Name | (5-chloro-4-methylthiophen-2-yl)-[4-(difluoromethoxy)phenyl]methanamine |
|---|---|
| PubChem CID | 102763534 |
| Molecular Formula | C13H12ClF2NOS |
| Molecular Weight | 303.76 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | (5-chloro-4-methylthiophen-2-yl)-[4-(difluoromethoxy)phenyl]methanamine |
| SMILES | Cc1cc(C(N)c2ccc(OC(F)F)cc2)sc1Cl |
| InChI | InChI=1S/C13H12ClF2NOS/c1-7-6-10(19-12(7)14)11(17)8-2-4-9(5-3-8)18-13(15)16/h2-6,11,13H,17H2,1H3 |
| InChIKey | ATXJUJLOVCXXGQ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.76 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |