C15H16Cl2FNS — CID 102764118
N-[(2-chloro-3-fluorophenyl)-(5-chloro-4-methylthiophen-2-yl)methyl]propan-1-amine (PubChem CID 102764118) has the molecular formula C15H16Cl2FNS and a molecular weight of 332.27 g/mol. Its IUPAC name is N-[(2-chloro-3-fluorophenyl)-(5-chloro-4-methylthiophen-2-yl)methyl]propan-1-amine.
| Compound Name | N-[(2-chloro-3-fluorophenyl)-(5-chloro-4-methylthiophen-2-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 102764118 |
| Molecular Formula | C15H16Cl2FNS |
| Molecular Weight | 332.27 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | N-[(2-chloro-3-fluorophenyl)-(5-chloro-4-methylthiophen-2-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1cc(C)c(Cl)s1)c1cccc(F)c1Cl |
| InChI | InChI=1S/C15H16Cl2FNS/c1-3-7-19-14(12-8-9(2)15(17)20-12)10-5-4-6-11(18)13(10)16/h4-6,8,14,19H,3,7H2,1-2H3 |
| InChIKey | NRFBYOBYANGMKO-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.27 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |