About (E)-3-[3-(2-butoxy-3,5-ditert-butylphenyl)-1H-indol-5-yl]but-2-enoic acid
(E)-3-[3-(2-butoxy-3,5-ditert-butylphenyl)-1H-indol-5-yl]but-2-enoic acid (PubChem CID 10276434) has the molecular formula C30H39NO3
and a molecular weight of 461.65 g/mol. Its IUPAC name is (E)-3-[3-(2-butoxy-3,5-ditert-butylphenyl)-1H-indol-5-yl]but-2-enoic acid.
Molecular Properties
| Compound Name | (E)-3-[3-(2-butoxy-3,5-ditert-butylphenyl)-1H-indol-5-yl]but-2-enoic acid |
| PubChem CID | 10276434 |
| Molecular Formula | C30H39NO3 |
| Molecular Weight | 461.65 g/mol |
| Exact Mass | 461.29 |
| IUPAC Name | (E)-3-[3-(2-butoxy-3,5-ditert-butylphenyl)-1H-indol-5-yl]but-2-enoic acid |
| SMILES | CCCCOc1c(-c2c[nH]c3ccc(/C(C)=C/C(=O)O)cc23)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C30H39NO3/c1-9-10-13-34-28-23(16-21(29(3,4)5)17-25(28)30(6,7)8)24-18-31-26-12-11-20(15-22(24)26)19(2)14-27(32)33/h11-12,14-18,31H,9-10,13H2,1-8H3,(H,32,33)/b19-14+ |
| InChIKey | CATUIEOZAVGOQU-XMHGGMMESA-N |
| XLogP | 8.10 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 461.65 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-[3-(2-butoxy-3,5-ditert-butylphenyl)-1H-indol-5-yl]but-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-[3-(2-butoxy-3,5-ditert-butylphenyl)-1H-indol-5-yl]but-2-enoic acid?
The IUPAC name of (E)-3-[3-(2-butoxy-3,5-ditert-butylphenyl)-1H-indol-5-yl]but-2-enoic acid (CID 10276434) is (E)-3-[3-(2-butoxy-3,5-ditert-butylphenyl)-1H-indol-5-yl]but-2-enoic acid.
What is the SMILES notation for (E)-3-[3-(2-butoxy-3,5-ditert-butylphenyl)-1H-indol-5-yl]but-2-enoic acid?
The canonical SMILES for (E)-3-[3-(2-butoxy-3,5-ditert-butylphenyl)-1H-indol-5-yl]but-2-enoic acid is CCCCOc1c(-c2c[nH]c3ccc(/C(C)=C/C(=O)O)cc23)cc(C(C)(C)C)cc1C(C)(C)C.
What is the InChIKey of (E)-3-[3-(2-butoxy-3,5-ditert-butylphenyl)-1H-indol-5-yl]but-2-enoic acid?
The InChIKey is CATUIEOZAVGOQU-XMHGGMMESA-N. The full InChI is InChI=1S/C30H39NO3/c1-9-10-13-34-28-23(16-21(29(3,4)5)17-25(28)30(6,7)8)24-18-31-26-12-11-20(15-22(24)26)19(2)14-27(32)33/h11-12,14-18,31H,9-10,13H2,1-8H3,(H,32,33)/b19-14+.
What are the key properties of (E)-3-[3-(2-butoxy-3,5-ditert-butylphenyl)-1H-indol-5-yl]but-2-enoic acid?
(E)-3-[3-(2-butoxy-3,5-ditert-butylphenyl)-1H-indol-5-yl]but-2-enoic acid has a molecular weight of 461.65 g/mol, XLogP of 8.10, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-[3-(2-butoxy-3,5-ditert-butylphenyl)-1H-indol-5-yl]but-2-enoic acid is sourced from PubChem (CID 10276434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).