C15H22Cl2S — CID 102764676
2-chloro-5-[chloro-[1-(2-methylpropyl)cyclopentyl]methyl]-3-methylthiophene (PubChem CID 102764676) has the molecular formula C15H22Cl2S and a molecular weight of 305.31 g/mol. Its IUPAC name is 2-chloro-5-[chloro-[1-(2-methylpropyl)cyclopentyl]methyl]-3-methylthiophene.
| Compound Name | 2-chloro-5-[chloro-[1-(2-methylpropyl)cyclopentyl]methyl]-3-methylthiophene |
|---|---|
| PubChem CID | 102764676 |
| Molecular Formula | C15H22Cl2S |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 2-chloro-5-[chloro-[1-(2-methylpropyl)cyclopentyl]methyl]-3-methylthiophene |
| SMILES | Cc1cc(C(Cl)C2(CC(C)C)CCCC2)sc1Cl |
| InChI | InChI=1S/C15H22Cl2S/c1-10(2)9-15(6-4-5-7-15)13(16)12-8-11(3)14(17)18-12/h8,10,13H,4-7,9H2,1-3H3 |
| InChIKey | JZUHFBOSHIULHC-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|