About 3-[(5-amino-1,3-thiazol-2-yl)-propan-2-ylamino]propan-1-ol
3-[(5-amino-1,3-thiazol-2-yl)-propan-2-ylamino]propan-1-ol (PubChem CID 102768036) has the molecular formula C9H17N3OS
and a molecular weight of 215.32 g/mol. Its IUPAC name is 3-[(5-amino-1,3-thiazol-2-yl)-propan-2-ylamino]propan-1-ol.
Molecular Properties
| Compound Name | 3-[(5-amino-1,3-thiazol-2-yl)-propan-2-ylamino]propan-1-ol |
| PubChem CID | 102768036 |
| Molecular Formula | C9H17N3OS |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 3-[(5-amino-1,3-thiazol-2-yl)-propan-2-ylamino]propan-1-ol |
| SMILES | CC(C)N(CCCO)c1ncc(N)s1 |
| InChI | InChI=1S/C9H17N3OS/c1-7(2)12(4-3-5-13)9-11-6-8(10)14-9/h6-7,13H,3-5,10H2,1-2H3 |
| InChIKey | VZGBFWHJHNBAEN-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 62.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(5-amino-1,3-thiazol-2-yl)-propan-2-ylamino]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-amino-1,3-thiazol-2-yl)-propan-2-ylamino]propan-1-ol?
The IUPAC name of 3-[(5-amino-1,3-thiazol-2-yl)-propan-2-ylamino]propan-1-ol (CID 102768036) is 3-[(5-amino-1,3-thiazol-2-yl)-propan-2-ylamino]propan-1-ol.
What is the SMILES notation for 3-[(5-amino-1,3-thiazol-2-yl)-propan-2-ylamino]propan-1-ol?
The canonical SMILES for 3-[(5-amino-1,3-thiazol-2-yl)-propan-2-ylamino]propan-1-ol is CC(C)N(CCCO)c1ncc(N)s1.
What is the InChIKey of 3-[(5-amino-1,3-thiazol-2-yl)-propan-2-ylamino]propan-1-ol?
The InChIKey is VZGBFWHJHNBAEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3OS/c1-7(2)12(4-3-5-13)9-11-6-8(10)14-9/h6-7,13H,3-5,10H2,1-2H3.
What are the key properties of 3-[(5-amino-1,3-thiazol-2-yl)-propan-2-ylamino]propan-1-ol?
3-[(5-amino-1,3-thiazol-2-yl)-propan-2-ylamino]propan-1-ol has a molecular weight of 215.32 g/mol, XLogP of 1.32, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-amino-1,3-thiazol-2-yl)-propan-2-ylamino]propan-1-ol is sourced from PubChem (CID 102768036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).