About 2-N-(2-butoxyethyl)-1,3-thiazole-2,5-diamine
2-N-(2-butoxyethyl)-1,3-thiazole-2,5-diamine (PubChem CID 102768179) has the molecular formula C9H17N3OS
and a molecular weight of 215.32 g/mol. Its IUPAC name is 2-N-(2-butoxyethyl)-1,3-thiazole-2,5-diamine.
Molecular Properties
| Compound Name | 2-N-(2-butoxyethyl)-1,3-thiazole-2,5-diamine |
| PubChem CID | 102768179 |
| Molecular Formula | C9H17N3OS |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 2-N-(2-butoxyethyl)-1,3-thiazole-2,5-diamine |
| SMILES | CCCCOCCNc1ncc(N)s1 |
| InChI | InChI=1S/C9H17N3OS/c1-2-3-5-13-6-4-11-9-12-7-8(10)14-9/h7H,2-6,10H2,1H3,(H,11,12) |
| InChIKey | CSFDPQTXBCFKOP-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-N-(2-butoxyethyl)-1,3-thiazole-2,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-(2-butoxyethyl)-1,3-thiazole-2,5-diamine?
The IUPAC name of 2-N-(2-butoxyethyl)-1,3-thiazole-2,5-diamine (CID 102768179) is 2-N-(2-butoxyethyl)-1,3-thiazole-2,5-diamine.
What is the SMILES notation for 2-N-(2-butoxyethyl)-1,3-thiazole-2,5-diamine?
The canonical SMILES for 2-N-(2-butoxyethyl)-1,3-thiazole-2,5-diamine is CCCCOCCNc1ncc(N)s1.
What is the InChIKey of 2-N-(2-butoxyethyl)-1,3-thiazole-2,5-diamine?
The InChIKey is CSFDPQTXBCFKOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3OS/c1-2-3-5-13-6-4-11-9-12-7-8(10)14-9/h7H,2-6,10H2,1H3,(H,11,12).
What are the key properties of 2-N-(2-butoxyethyl)-1,3-thiazole-2,5-diamine?
2-N-(2-butoxyethyl)-1,3-thiazole-2,5-diamine has a molecular weight of 215.32 g/mol, XLogP of 1.95, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-(2-butoxyethyl)-1,3-thiazole-2,5-diamine is sourced from PubChem (CID 102768179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).