About 2-N-(3-methoxy-2-methylpropyl)-1,3-thiazole-2,5-diamine
2-N-(3-methoxy-2-methylpropyl)-1,3-thiazole-2,5-diamine (PubChem CID 102768192) has the molecular formula C8H15N3OS
and a molecular weight of 201.29 g/mol. Its IUPAC name is 2-N-(3-methoxy-2-methylpropyl)-1,3-thiazole-2,5-diamine.
Molecular Properties
| Compound Name | 2-N-(3-methoxy-2-methylpropyl)-1,3-thiazole-2,5-diamine |
| PubChem CID | 102768192 |
| Molecular Formula | C8H15N3OS |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 2-N-(3-methoxy-2-methylpropyl)-1,3-thiazole-2,5-diamine |
| SMILES | COCC(C)CNc1ncc(N)s1 |
| InChI | InChI=1S/C8H15N3OS/c1-6(5-12-2)3-10-8-11-4-7(9)13-8/h4,6H,3,5,9H2,1-2H3,(H,10,11) |
| InChIKey | OUIWGERGNQKFGT-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-N-(3-methoxy-2-methylpropyl)-1,3-thiazole-2,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-(3-methoxy-2-methylpropyl)-1,3-thiazole-2,5-diamine?
The IUPAC name of 2-N-(3-methoxy-2-methylpropyl)-1,3-thiazole-2,5-diamine (CID 102768192) is 2-N-(3-methoxy-2-methylpropyl)-1,3-thiazole-2,5-diamine.
What is the SMILES notation for 2-N-(3-methoxy-2-methylpropyl)-1,3-thiazole-2,5-diamine?
The canonical SMILES for 2-N-(3-methoxy-2-methylpropyl)-1,3-thiazole-2,5-diamine is COCC(C)CNc1ncc(N)s1.
What is the InChIKey of 2-N-(3-methoxy-2-methylpropyl)-1,3-thiazole-2,5-diamine?
The InChIKey is OUIWGERGNQKFGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3OS/c1-6(5-12-2)3-10-8-11-4-7(9)13-8/h4,6H,3,5,9H2,1-2H3,(H,10,11).
What are the key properties of 2-N-(3-methoxy-2-methylpropyl)-1,3-thiazole-2,5-diamine?
2-N-(3-methoxy-2-methylpropyl)-1,3-thiazole-2,5-diamine has a molecular weight of 201.29 g/mol, XLogP of 1.42, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-(3-methoxy-2-methylpropyl)-1,3-thiazole-2,5-diamine is sourced from PubChem (CID 102768192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).