C9H6F3N3S — CID 102768335
2-N-(2,3,5-trifluorophenyl)-1,3-thiazole-2,5-diamine (PubChem CID 102768335) has the molecular formula C9H6F3N3S and a molecular weight of 245.23 g/mol. Its IUPAC name is 2-N-(2,3,5-trifluorophenyl)-1,3-thiazole-2,5-diamine.
| Compound Name | 2-N-(2,3,5-trifluorophenyl)-1,3-thiazole-2,5-diamine |
|---|---|
| PubChem CID | 102768335 |
| Molecular Formula | C9H6F3N3S |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.02 |
| IUPAC Name | 2-N-(2,3,5-trifluorophenyl)-1,3-thiazole-2,5-diamine |
| SMILES | Nc1cnc(Nc2cc(F)cc(F)c2F)s1 |
| InChI | InChI=1S/C9H6F3N3S/c10-4-1-5(11)8(12)6(2-4)15-9-14-3-7(13)16-9/h1-3H,13H2,(H,14,15) |
| InChIKey | RXMAGNDANANAIQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|