C9H12F3N3S — CID 102768637
2-[3-(trifluoromethyl)piperidin-1-yl]-1,3-thiazol-5-amine (PubChem CID 102768637) has the molecular formula C9H12F3N3S and a molecular weight of 251.28 g/mol. Its IUPAC name is 2-[3-(trifluoromethyl)piperidin-1-yl]-1,3-thiazol-5-amine.
| Compound Name | 2-[3-(trifluoromethyl)piperidin-1-yl]-1,3-thiazol-5-amine |
|---|---|
| PubChem CID | 102768637 |
| Molecular Formula | C9H12F3N3S |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 2-[3-(trifluoromethyl)piperidin-1-yl]-1,3-thiazol-5-amine |
| SMILES | Nc1cnc(N2CCCC(C(F)(F)F)C2)s1 |
| InChI | InChI=1S/C9H12F3N3S/c10-9(11,12)6-2-1-3-15(5-6)8-14-4-7(13)16-8/h4,6H,1-3,5,13H2 |
| InChIKey | LHHUJYYQPPEZLL-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |