C5H7F2N3S — CID 102768855
2-N-(2,2-difluoroethyl)-1,3-thiazole-2,5-diamine (PubChem CID 102768855) has the molecular formula C5H7F2N3S and a molecular weight of 179.20 g/mol. Its IUPAC name is 2-N-(2,2-difluoroethyl)-1,3-thiazole-2,5-diamine.
| Compound Name | 2-N-(2,2-difluoroethyl)-1,3-thiazole-2,5-diamine |
|---|---|
| PubChem CID | 102768855 |
| Molecular Formula | C5H7F2N3S |
| Molecular Weight | 179.20 g/mol |
| Exact Mass | 179.03 |
| IUPAC Name | 2-N-(2,2-difluoroethyl)-1,3-thiazole-2,5-diamine |
| SMILES | Nc1cnc(NCC(F)F)s1 |
| InChI | InChI=1S/C5H7F2N3S/c6-3(7)1-9-5-10-2-4(8)11-5/h2-3H,1,8H2,(H,9,10) |
| InChIKey | WZBIQUXVLHKTBR-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.20 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |