About 4-[(5-amino-1,3-thiazol-2-yl)-methylamino]butan-2-ol
4-[(5-amino-1,3-thiazol-2-yl)-methylamino]butan-2-ol (PubChem CID 102769067) has the molecular formula C8H15N3OS
and a molecular weight of 201.30 g/mol. Its IUPAC name is 4-[(5-amino-1,3-thiazol-2-yl)-methylamino]butan-2-ol.
Molecular Properties
| Compound Name | 4-[(5-amino-1,3-thiazol-2-yl)-methylamino]butan-2-ol |
| PubChem CID | 102769067 |
| Molecular Formula | C8H15N3OS |
| Molecular Weight | 201.30 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 4-[(5-amino-1,3-thiazol-2-yl)-methylamino]butan-2-ol |
| SMILES | CC(O)CCN(C)c1ncc(N)s1 |
| InChI | InChI=1S/C8H15N3OS/c1-6(12)3-4-11(2)8-10-5-7(9)13-8/h5-6,12H,3-4,9H2,1-2H3 |
| InChIKey | SEAVZGAFHSTSCN-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 62.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.30 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(5-amino-1,3-thiazol-2-yl)-methylamino]butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(5-amino-1,3-thiazol-2-yl)-methylamino]butan-2-ol?
The IUPAC name of 4-[(5-amino-1,3-thiazol-2-yl)-methylamino]butan-2-ol (CID 102769067) is 4-[(5-amino-1,3-thiazol-2-yl)-methylamino]butan-2-ol.
What is the SMILES notation for 4-[(5-amino-1,3-thiazol-2-yl)-methylamino]butan-2-ol?
The canonical SMILES for 4-[(5-amino-1,3-thiazol-2-yl)-methylamino]butan-2-ol is CC(O)CCN(C)c1ncc(N)s1.
What is the InChIKey of 4-[(5-amino-1,3-thiazol-2-yl)-methylamino]butan-2-ol?
The InChIKey is SEAVZGAFHSTSCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3OS/c1-6(12)3-4-11(2)8-10-5-7(9)13-8/h5-6,12H,3-4,9H2,1-2H3.
What are the key properties of 4-[(5-amino-1,3-thiazol-2-yl)-methylamino]butan-2-ol?
4-[(5-amino-1,3-thiazol-2-yl)-methylamino]butan-2-ol has a molecular weight of 201.30 g/mol, XLogP of 0.93, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5-amino-1,3-thiazol-2-yl)-methylamino]butan-2-ol is sourced from PubChem (CID 102769067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).