C18H31BrN2 — CID 102769543
N-[[3-bromo-4-[[propan-2-yl(propyl)amino]methyl]phenyl]methyl]-2-methylpropan-1-amine (PubChem CID 102769543) has the molecular formula C18H31BrN2 and a molecular weight of 355.36 g/mol. Its IUPAC name is N-[[3-bromo-4-[[propan-2-yl(propyl)amino]methyl]phenyl]methyl]-2-methylpropan-1-amine.
| Compound Name | N-[[3-bromo-4-[[propan-2-yl(propyl)amino]methyl]phenyl]methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 102769543 |
| Molecular Formula | C18H31BrN2 |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | N-[[3-bromo-4-[[propan-2-yl(propyl)amino]methyl]phenyl]methyl]-2-methylpropan-1-amine |
| SMILES | CCCN(Cc1ccc(CNCC(C)C)cc1Br)C(C)C |
| InChI | InChI=1S/C18H31BrN2/c1-6-9-21(15(4)5)13-17-8-7-16(10-18(17)19)12-20-11-14(2)3/h7-8,10,14-15,20H,6,9,11-13H2,1-5H3 |
| InChIKey | DMAJZMLKWVMJAD-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |