About 2-(oxetan-3-yloxy)-1,3-thiazol-5-amine
2-(oxetan-3-yloxy)-1,3-thiazol-5-amine (PubChem CID 102769635) has the molecular formula C6H8N2O2S
and a molecular weight of 172.21 g/mol. Its IUPAC name is 2-(oxetan-3-yloxy)-1,3-thiazol-5-amine.
Molecular Properties
| Compound Name | 2-(oxetan-3-yloxy)-1,3-thiazol-5-amine |
| PubChem CID | 102769635 |
| Molecular Formula | C6H8N2O2S |
| Molecular Weight | 172.21 g/mol |
| Exact Mass | 172.03 |
| IUPAC Name | 2-(oxetan-3-yloxy)-1,3-thiazol-5-amine |
| SMILES | Nc1cnc(OC2COC2)s1 |
| InChI | InChI=1S/C6H8N2O2S/c7-5-1-8-6(11-5)10-4-2-9-3-4/h1,4H,2-3,7H2 |
| InChIKey | ZEJDMHQTFZDFTJ-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.21 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(oxetan-3-yloxy)-1,3-thiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxetan-3-yloxy)-1,3-thiazol-5-amine?
The IUPAC name of 2-(oxetan-3-yloxy)-1,3-thiazol-5-amine (CID 102769635) is 2-(oxetan-3-yloxy)-1,3-thiazol-5-amine.
What is the SMILES notation for 2-(oxetan-3-yloxy)-1,3-thiazol-5-amine?
The canonical SMILES for 2-(oxetan-3-yloxy)-1,3-thiazol-5-amine is Nc1cnc(OC2COC2)s1.
What is the InChIKey of 2-(oxetan-3-yloxy)-1,3-thiazol-5-amine?
The InChIKey is ZEJDMHQTFZDFTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2S/c7-5-1-8-6(11-5)10-4-2-9-3-4/h1,4H,2-3,7H2.
What are the key properties of 2-(oxetan-3-yloxy)-1,3-thiazol-5-amine?
2-(oxetan-3-yloxy)-1,3-thiazol-5-amine has a molecular weight of 172.21 g/mol, XLogP of 0.50, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxetan-3-yloxy)-1,3-thiazol-5-amine is sourced from PubChem (CID 102769635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).