About 3-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]propanoic acid
3-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]propanoic acid (PubChem CID 102770068) has the molecular formula C6H6N2O4S2
and a molecular weight of 234.26 g/mol. Its IUPAC name is 3-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]propanoic acid.
Molecular Properties
| Compound Name | 3-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]propanoic acid |
| PubChem CID | 102770068 |
| Molecular Formula | C6H6N2O4S2 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 233.98 |
| IUPAC Name | 3-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]propanoic acid |
| SMILES | O=C(O)CCSc1ncc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C6H6N2O4S2/c9-5(10)1-2-13-6-7-3-4(14-6)8(11)12/h3H,1-2H2,(H,9,10) |
| InChIKey | IMFNXQSAGSYMMS-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 93.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]propanoic acid?
The IUPAC name of 3-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]propanoic acid (CID 102770068) is 3-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]propanoic acid.
What is the SMILES notation for 3-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]propanoic acid?
The canonical SMILES for 3-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]propanoic acid is O=C(O)CCSc1ncc([N+](=O)[O-])s1.
What is the InChIKey of 3-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]propanoic acid?
The InChIKey is IMFNXQSAGSYMMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O4S2/c9-5(10)1-2-13-6-7-3-4(14-6)8(11)12/h3H,1-2H2,(H,9,10).
What are the key properties of 3-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]propanoic acid?
3-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]propanoic acid has a molecular weight of 234.26 g/mol, XLogP of 1.62, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]propanoic acid is sourced from PubChem (CID 102770068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).