C7H8N2O4S2 — CID 102770092
3-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]butanoic acid (PubChem CID 102770092) has the molecular formula C7H8N2O4S2 and a molecular weight of 248.28 g/mol. Its IUPAC name is 3-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]butanoic acid.
| Compound Name | 3-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]butanoic acid |
|---|---|
| PubChem CID | 102770092 |
| Molecular Formula | C7H8N2O4S2 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 247.99 |
| IUPAC Name | 3-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]butanoic acid |
| SMILES | CC(CC(=O)O)Sc1ncc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C7H8N2O4S2/c1-4(2-6(10)11)14-7-8-3-5(15-7)9(12)13/h3-4H,2H2,1H3,(H,10,11) |
| InChIKey | CWNBXXFIBAYFQZ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 93.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|