About methyl 3-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]butanoate
methyl 3-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]butanoate (PubChem CID 102770093) has the molecular formula C8H10N2O4S2
and a molecular weight of 262.31 g/mol. Its IUPAC name is methyl 3-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]butanoate.
Molecular Properties
| Compound Name | methyl 3-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]butanoate |
| PubChem CID | 102770093 |
| Molecular Formula | C8H10N2O4S2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.01 |
| IUPAC Name | methyl 3-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]butanoate |
| SMILES | COC(=O)CC(C)Sc1ncc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C8H10N2O4S2/c1-5(3-7(11)14-2)15-8-9-4-6(16-8)10(12)13/h4-5H,3H2,1-2H3 |
| InChIKey | RCVIOOQCNLYHGV-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 82.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]butanoate?
The IUPAC name of methyl 3-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]butanoate (CID 102770093) is methyl 3-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]butanoate.
What is the SMILES notation for methyl 3-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]butanoate?
The canonical SMILES for methyl 3-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]butanoate is COC(=O)CC(C)Sc1ncc([N+](=O)[O-])s1.
What is the InChIKey of methyl 3-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]butanoate?
The InChIKey is RCVIOOQCNLYHGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O4S2/c1-5(3-7(11)14-2)15-8-9-4-6(16-8)10(12)13/h4-5H,3H2,1-2H3.
What are the key properties of methyl 3-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]butanoate?
methyl 3-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]butanoate has a molecular weight of 262.31 g/mol, XLogP of 2.10, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]butanoate is sourced from PubChem (CID 102770093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).