About 2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]butanoic acid
2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]butanoic acid (PubChem CID 102770109) has the molecular formula C7H8N2O4S2
and a molecular weight of 248.28 g/mol. Its IUPAC name is 2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]butanoic acid.
Molecular Properties
| Compound Name | 2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]butanoic acid |
| PubChem CID | 102770109 |
| Molecular Formula | C7H8N2O4S2 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 247.99 |
| IUPAC Name | 2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]butanoic acid |
| SMILES | CCC(Sc1ncc([N+](=O)[O-])s1)C(=O)O |
| InChI | InChI=1S/C7H8N2O4S2/c1-2-4(6(10)11)14-7-8-3-5(15-7)9(12)13/h3-4H,2H2,1H3,(H,10,11) |
| InChIKey | QOHPLFGPSIPGKR-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 93.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]butanoic acid?
The IUPAC name of 2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]butanoic acid (CID 102770109) is 2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]butanoic acid.
What is the SMILES notation for 2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]butanoic acid?
The canonical SMILES for 2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]butanoic acid is CCC(Sc1ncc([N+](=O)[O-])s1)C(=O)O.
What is the InChIKey of 2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]butanoic acid?
The InChIKey is QOHPLFGPSIPGKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O4S2/c1-2-4(6(10)11)14-7-8-3-5(15-7)9(12)13/h3-4H,2H2,1H3,(H,10,11).
What are the key properties of 2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]butanoic acid?
2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]butanoic acid has a molecular weight of 248.28 g/mol, XLogP of 2.01, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]butanoic acid is sourced from PubChem (CID 102770109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).