About 2-(2,4-difluorophenyl)sulfanyl-1,3-thiazol-5-amine
2-(2,4-difluorophenyl)sulfanyl-1,3-thiazol-5-amine (PubChem CID 102770251) has the molecular formula C9H6F2N2S2
and a molecular weight of 244.29 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)sulfanyl-1,3-thiazol-5-amine.
Molecular Properties
| Compound Name | 2-(2,4-difluorophenyl)sulfanyl-1,3-thiazol-5-amine |
| PubChem CID | 102770251 |
| Molecular Formula | C9H6F2N2S2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 243.99 |
| IUPAC Name | 2-(2,4-difluorophenyl)sulfanyl-1,3-thiazol-5-amine |
| SMILES | Nc1cnc(Sc2ccc(F)cc2F)s1 |
| InChI | InChI=1S/C9H6F2N2S2/c10-5-1-2-7(6(11)3-5)14-9-13-4-8(12)15-9/h1-4H,12H2 |
| InChIKey | YTOBCUODNYOGJO-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,4-difluorophenyl)sulfanyl-1,3-thiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-difluorophenyl)sulfanyl-1,3-thiazol-5-amine?
The IUPAC name of 2-(2,4-difluorophenyl)sulfanyl-1,3-thiazol-5-amine (CID 102770251) is 2-(2,4-difluorophenyl)sulfanyl-1,3-thiazol-5-amine.
What is the SMILES notation for 2-(2,4-difluorophenyl)sulfanyl-1,3-thiazol-5-amine?
The canonical SMILES for 2-(2,4-difluorophenyl)sulfanyl-1,3-thiazol-5-amine is Nc1cnc(Sc2ccc(F)cc2F)s1.
What is the InChIKey of 2-(2,4-difluorophenyl)sulfanyl-1,3-thiazol-5-amine?
The InChIKey is YTOBCUODNYOGJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6F2N2S2/c10-5-1-2-7(6(11)3-5)14-9-13-4-8(12)15-9/h1-4H,12H2.
What are the key properties of 2-(2,4-difluorophenyl)sulfanyl-1,3-thiazol-5-amine?
2-(2,4-difluorophenyl)sulfanyl-1,3-thiazol-5-amine has a molecular weight of 244.29 g/mol, XLogP of 3.15, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-difluorophenyl)sulfanyl-1,3-thiazol-5-amine is sourced from PubChem (CID 102770251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).