About N-[2-(2,4-dichlorophenyl)ethyl]-5-nitro-1,3-thiazol-2-amine
N-[2-(2,4-dichlorophenyl)ethyl]-5-nitro-1,3-thiazol-2-amine (PubChem CID 102770406) has the molecular formula C11H9Cl2N3O2S
and a molecular weight of 318.19 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]-5-nitro-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]-5-nitro-1,3-thiazol-2-amine |
| PubChem CID | 102770406 |
| Molecular Formula | C11H9Cl2N3O2S |
| Molecular Weight | 318.19 g/mol |
| Exact Mass | 316.98 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]-5-nitro-1,3-thiazol-2-amine |
| SMILES | O=[N+]([O-])c1cnc(NCCc2ccc(Cl)cc2Cl)s1 |
| InChI | InChI=1S/C11H9Cl2N3O2S/c12-8-2-1-7(9(13)5-8)3-4-14-11-15-6-10(19-11)16(17)18/h1-2,5-6H,3-4H2,(H,14,15) |
| InChIKey | ALLLCRPGMXUDKV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.19 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(2,4-dichlorophenyl)ethyl]-5-nitro-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2,4-dichlorophenyl)ethyl]-5-nitro-1,3-thiazol-2-amine?
The IUPAC name of N-[2-(2,4-dichlorophenyl)ethyl]-5-nitro-1,3-thiazol-2-amine (CID 102770406) is N-[2-(2,4-dichlorophenyl)ethyl]-5-nitro-1,3-thiazol-2-amine.
What is the SMILES notation for N-[2-(2,4-dichlorophenyl)ethyl]-5-nitro-1,3-thiazol-2-amine?
The canonical SMILES for N-[2-(2,4-dichlorophenyl)ethyl]-5-nitro-1,3-thiazol-2-amine is O=[N+]([O-])c1cnc(NCCc2ccc(Cl)cc2Cl)s1.
What is the InChIKey of N-[2-(2,4-dichlorophenyl)ethyl]-5-nitro-1,3-thiazol-2-amine?
The InChIKey is ALLLCRPGMXUDKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9Cl2N3O2S/c12-8-2-1-7(9(13)5-8)3-4-14-11-15-6-10(19-11)16(17)18/h1-2,5-6H,3-4H2,(H,14,15).
What are the key properties of N-[2-(2,4-dichlorophenyl)ethyl]-5-nitro-1,3-thiazol-2-amine?
N-[2-(2,4-dichlorophenyl)ethyl]-5-nitro-1,3-thiazol-2-amine has a molecular weight of 318.19 g/mol, XLogP of 4.01, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2,4-dichlorophenyl)ethyl]-5-nitro-1,3-thiazol-2-amine is sourced from PubChem (CID 102770406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).