C26H30F3N3O2 — CID 10277064
N-[4-[9-(2,2,2-trifluoroethylcarbamoyl)fluoren-9-yl]butyl]piperidine-4-carboxamide (PubChem CID 10277064) has the molecular formula C26H30F3N3O2 and a molecular weight of 473.54 g/mol. Its IUPAC name is N-[4-[9-(2,2,2-trifluoroethylcarbamoyl)fluoren-9-yl]butyl]piperidine-4-carboxamide.
| Compound Name | N-[4-[9-(2,2,2-trifluoroethylcarbamoyl)fluoren-9-yl]butyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 10277064 |
| Molecular Formula | C26H30F3N3O2 |
| Molecular Weight | 473.54 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | N-[4-[9-(2,2,2-trifluoroethylcarbamoyl)fluoren-9-yl]butyl]piperidine-4-carboxamide |
| SMILES | O=C(NCCCCC1(C(=O)NCC(F)(F)F)c2ccccc2-c2ccccc21)C1CCNCC1 |
| InChI | InChI=1S/C26H30F3N3O2/c27-26(28,29)17-32-24(34)25(13-5-6-14-31-23(33)18-11-15-30-16-12-18)21-9-3-1-7-19(21)20-8-2-4-10-22(20)25/h1-4,7-10,18,30H,5-6,11-17H2,(H,31,33)(H,32,34) |
| InChIKey | LSQRBDSACMRMOT-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.54 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|