C10H14N4O2S — CID 102770677
N-(1-cyclopropylpyrrolidin-3-yl)-5-nitro-1,3-thiazol-2-amine (PubChem CID 102770677) has the molecular formula C10H14N4O2S and a molecular weight of 254.31 g/mol. Its IUPAC name is N-(1-cyclopropylpyrrolidin-3-yl)-5-nitro-1,3-thiazol-2-amine.
| Compound Name | N-(1-cyclopropylpyrrolidin-3-yl)-5-nitro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 102770677 |
| Molecular Formula | C10H14N4O2S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | N-(1-cyclopropylpyrrolidin-3-yl)-5-nitro-1,3-thiazol-2-amine |
| SMILES | O=[N+]([O-])c1cnc(NC2CCN(C3CC3)C2)s1 |
| InChI | InChI=1S/C10H14N4O2S/c15-14(16)9-5-11-10(17-9)12-7-3-4-13(6-7)8-1-2-8/h5,7-8H,1-4,6H2,(H,11,12) |
| InChIKey | JHYQAPSBKNRNKG-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|