C25H26ClF2N3O2 — CID 10277090
6-chloro-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]pyridine-3-carboxamide (PubChem CID 10277090) has the molecular formula C25H26ClF2N3O2 and a molecular weight of 473.95 g/mol. Its IUPAC name is 6-chloro-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 10277090 |
| Molecular Formula | C25H26ClF2N3O2 |
| Molecular Weight | 473.95 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | 6-chloro-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]pyridine-3-carboxamide |
| SMILES | CCc1cccc(CNC[C@@H](O)[C@H](Cc2cc(F)cc(F)c2)NC(=O)c2ccc(Cl)nc2)c1 |
| InChI | InChI=1S/C25H26ClF2N3O2/c1-2-16-4-3-5-17(8-16)13-29-15-23(32)22(11-18-9-20(27)12-21(28)10-18)31-25(33)19-6-7-24(26)30-14-19/h3-10,12,14,22-23,29,32H,2,11,13,15H2,1H3,(H,31,33)/t22-,23+/m0/s1 |
| InChIKey | SMRXAKRCIMXEJK-XZOQPEGZSA-N |
| XLogP | 4.07 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.95 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|