C17H25BrN2 — CID 102771942
N-[[3-bromo-4-[[methyl(pent-4-enyl)amino]methyl]phenyl]methyl]cyclopropanamine (PubChem CID 102771942) has the molecular formula C17H25BrN2 and a molecular weight of 337.31 g/mol. Its IUPAC name is N-[[3-bromo-4-[[methyl(pent-4-enyl)amino]methyl]phenyl]methyl]cyclopropanamine.
| Compound Name | N-[[3-bromo-4-[[methyl(pent-4-enyl)amino]methyl]phenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 102771942 |
| Molecular Formula | C17H25BrN2 |
| Molecular Weight | 337.31 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | N-[[3-bromo-4-[[methyl(pent-4-enyl)amino]methyl]phenyl]methyl]cyclopropanamine |
| SMILES | C=CCCCN(C)Cc1ccc(CNC2CC2)cc1Br |
| InChI | InChI=1S/C17H25BrN2/c1-3-4-5-10-20(2)13-15-7-6-14(11-17(15)18)12-19-16-8-9-16/h3,6-7,11,16,19H,1,4-5,8-10,12-13H2,2H3 |
| InChIKey | FJFVORAFTPSMOQ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.31 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|