C13H16BrN3O — CID 102774129
[3-bromo-4-[(1-ethylpyrazol-4-yl)oxymethyl]phenyl]methanamine (PubChem CID 102774129) has the molecular formula C13H16BrN3O and a molecular weight of 310.20 g/mol. Its IUPAC name is [3-bromo-4-[(1-ethylpyrazol-4-yl)oxymethyl]phenyl]methanamine.
| Compound Name | [3-bromo-4-[(1-ethylpyrazol-4-yl)oxymethyl]phenyl]methanamine |
|---|---|
| PubChem CID | 102774129 |
| Molecular Formula | C13H16BrN3O |
| Molecular Weight | 310.20 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | [3-bromo-4-[(1-ethylpyrazol-4-yl)oxymethyl]phenyl]methanamine |
| SMILES | CCn1cc(OCc2ccc(CN)cc2Br)cn1 |
| InChI | InChI=1S/C13H16BrN3O/c1-2-17-8-12(7-16-17)18-9-11-4-3-10(6-15)5-13(11)14/h3-5,7-8H,2,6,9,15H2,1H3 |
| InChIKey | PMWCATDOIJIMJC-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.20 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |