C25H38ClN3O4 — CID 10277466
1-butyl-9-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-3-(2-methylpropyl)-1,4,9-triazaspiro[5.5]undecane-2,5-dione;hydrochloride (PubChem CID 10277466) has the molecular formula C25H38ClN3O4 and a molecular weight of 480.05 g/mol. Its IUPAC name is 1-butyl-9-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-3-(2-methylpropyl)-1,4,9-triazaspiro[5.5]undecane-2,5-dione;hydrochloride.
| Compound Name | 1-butyl-9-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-3-(2-methylpropyl)-1,4,9-triazaspiro[5.5]undecane-2,5-dione;hydrochloride |
|---|---|
| PubChem CID | 10277466 |
| Molecular Formula | C25H38ClN3O4 |
| Molecular Weight | 480.05 g/mol |
| Exact Mass | 479.26 |
| IUPAC Name | 1-butyl-9-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-3-(2-methylpropyl)-1,4,9-triazaspiro[5.5]undecane-2,5-dione;hydrochloride |
| SMILES | CCCCN1C(=O)C(CC(C)C)NC(=O)C12CCN(Cc1ccc3c(c1)OCCO3)CC2.Cl |
| InChI | InChI=1S/C25H37N3O4.ClH/c1-4-5-10-28-23(29)20(15-18(2)3)26-24(30)25(28)8-11-27(12-9-25)17-19-6-7-21-22(16-19)32-14-13-31-21;/h6-7,16,18,20H,4-5,8-15,17H2,1-3H3,(H,26,30);1H |
| InChIKey | KAFXCXGMNHARKK-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.05 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |