C15H23BrN4O — CID 102774742
3-bromo-4-[[3-(dimethylamino)-4-methylpyrrolidin-1-yl]methyl]benzohydrazide (PubChem CID 102774742) has the molecular formula C15H23BrN4O and a molecular weight of 355.28 g/mol. Its IUPAC name is 3-bromo-4-[[3-(dimethylamino)-4-methylpyrrolidin-1-yl]methyl]benzohydrazide.
| Compound Name | 3-bromo-4-[[3-(dimethylamino)-4-methylpyrrolidin-1-yl]methyl]benzohydrazide |
|---|---|
| PubChem CID | 102774742 |
| Molecular Formula | C15H23BrN4O |
| Molecular Weight | 355.28 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 3-bromo-4-[[3-(dimethylamino)-4-methylpyrrolidin-1-yl]methyl]benzohydrazide |
| SMILES | CC1CN(Cc2ccc(C(=O)NN)cc2Br)CC1N(C)C |
| InChI | InChI=1S/C15H23BrN4O/c1-10-7-20(9-14(10)19(2)3)8-12-5-4-11(6-13(12)16)15(21)18-17/h4-6,10,14H,7-9,17H2,1-3H3,(H,18,21) |
| InChIKey | CAFJUWQLQSBJJG-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.28 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|