C25H26ClFN6O — CID 10277532
N-(3-chloro-4-fluorophenyl)-6-[4-[(2-morpholin-4-ylethylamino)methyl]phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 10277532) has the molecular formula C25H26ClFN6O and a molecular weight of 480.98 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-6-[4-[(2-morpholin-4-ylethylamino)methyl]phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | N-(3-chloro-4-fluorophenyl)-6-[4-[(2-morpholin-4-ylethylamino)methyl]phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 10277532 |
| Molecular Formula | C25H26ClFN6O |
| Molecular Weight | 480.98 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-6-[4-[(2-morpholin-4-ylethylamino)methyl]phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | Fc1ccc(Nc2ncnc3[nH]c(-c4ccc(CNCCN5CCOCC5)cc4)cc23)cc1Cl |
| InChI | InChI=1S/C25H26ClFN6O/c26-21-13-19(5-6-22(21)27)31-24-20-14-23(32-25(20)30-16-29-24)18-3-1-17(2-4-18)15-28-7-8-33-9-11-34-12-10-33/h1-6,13-14,16,28H,7-12,15H2,(H2,29,30,31,32) |
| InChIKey | PPUFDICGNSVHNB-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.98 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|