C25H27N3O7 — CID 10277556
(19S)-8-[(dimethylamino)methyl]-19-ethyl-7,19-dihydroxy-12-(2-hydroxyethoxy)-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaene-14,18-dione (PubChem CID 10277556) has the molecular formula C25H27N3O7 and a molecular weight of 481.51 g/mol. Its IUPAC name is (19S)-8-[(dimethylamino)methyl]-19-ethyl-7,19-dihydroxy-12-(2-hydroxyethoxy)-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaene-14,18-dione.
| Compound Name | (19S)-8-[(dimethylamino)methyl]-19-ethyl-7,19-dihydroxy-12-(2-hydroxyethoxy)-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaene-14,18-dione |
|---|---|
| PubChem CID | 10277556 |
| Molecular Formula | C25H27N3O7 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | (19S)-8-[(dimethylamino)methyl]-19-ethyl-7,19-dihydroxy-12-(2-hydroxyethoxy)-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaene-14,18-dione |
| SMILES | CC[C@@]1(O)C(=O)OCc2c1cc1n(c2=O)C(OCCO)c2cc3c(CN(C)C)c(O)ccc3nc2-1 |
| InChI | InChI=1S/C25H27N3O7/c1-4-25(33)17-10-19-21-14(9-13-15(11-27(2)3)20(30)6-5-18(13)26-21)23(34-8-7-29)28(19)22(31)16(17)12-35-24(25)32/h5-6,9-10,23,29-30,33H,4,7-8,11-12H2,1-3H3/t23?,25-/m0/s1 |
| InChIKey | IXQYQYYIAUFYIB-YNMFNDETSA-N |
| XLogP | 1.35 |
| TPSA | 134.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|