C28H29F2NO4 — CID 10277563
[3-[(1R,2R)-2-[(dimethylamino)methyl]-1-hydroxycyclohexyl]phenyl] 4-(2,4-difluorophenyl)-2-hydroxybenzoate (PubChem CID 10277563) has the molecular formula C28H29F2NO4 and a molecular weight of 481.54 g/mol. Its IUPAC name is [3-[(1R,2R)-2-[(dimethylamino)methyl]-1-hydroxycyclohexyl]phenyl] 4-(2,4-difluorophenyl)-2-hydroxybenzoate.
| Compound Name | [3-[(1R,2R)-2-[(dimethylamino)methyl]-1-hydroxycyclohexyl]phenyl] 4-(2,4-difluorophenyl)-2-hydroxybenzoate |
|---|---|
| PubChem CID | 10277563 |
| Molecular Formula | C28H29F2NO4 |
| Molecular Weight | 481.54 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | [3-[(1R,2R)-2-[(dimethylamino)methyl]-1-hydroxycyclohexyl]phenyl] 4-(2,4-difluorophenyl)-2-hydroxybenzoate |
| SMILES | CN(C)C[C@H]1CCCC[C@]1(O)c1cccc(OC(=O)c2ccc(-c3ccc(F)cc3F)cc2O)c1 |
| InChI | InChI=1S/C28H29F2NO4/c1-31(2)17-20-6-3-4-13-28(20,34)19-7-5-8-22(15-19)35-27(33)24-11-9-18(14-26(24)32)23-12-10-21(29)16-25(23)30/h5,7-12,14-16,20,32,34H,3-4,6,13,17H2,1-2H3/t20-,28+/m1/s1 |
| InChIKey | WJOQPZSFIBOCCJ-NGOKVRLYSA-N |
| XLogP | 5.50 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.54 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|