C14H16BrNO3S — CID 102775770
1-[2-(4-bromophenyl)sulfanylacetyl]-3-methylpyrrolidine-2-carboxylic acid (PubChem CID 102775770) has the molecular formula C14H16BrNO3S and a molecular weight of 358.26 g/mol. Its IUPAC name is 1-[2-(4-bromophenyl)sulfanylacetyl]-3-methylpyrrolidine-2-carboxylic acid.
| Compound Name | 1-[2-(4-bromophenyl)sulfanylacetyl]-3-methylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 102775770 |
| Molecular Formula | C14H16BrNO3S |
| Molecular Weight | 358.26 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | 1-[2-(4-bromophenyl)sulfanylacetyl]-3-methylpyrrolidine-2-carboxylic acid |
| SMILES | CC1CCN(C(=O)CSc2ccc(Br)cc2)C1C(=O)O |
| InChI | InChI=1S/C14H16BrNO3S/c1-9-6-7-16(13(9)14(18)19)12(17)8-20-11-4-2-10(15)3-5-11/h2-5,9,13H,6-8H2,1H3,(H,18,19) |
| InChIKey | OWRNXWPZDPRSDS-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.26 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |