C10H17NO5S — CID 102776307
3-methyl-1-(2-methylsulfonylpropanoyl)pyrrolidine-2-carboxylic acid (PubChem CID 102776307) has the molecular formula C10H17NO5S and a molecular weight of 263.31 g/mol. Its IUPAC name is 3-methyl-1-(2-methylsulfonylpropanoyl)pyrrolidine-2-carboxylic acid.
| Compound Name | 3-methyl-1-(2-methylsulfonylpropanoyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 102776307 |
| Molecular Formula | C10H17NO5S |
| Molecular Weight | 263.31 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 3-methyl-1-(2-methylsulfonylpropanoyl)pyrrolidine-2-carboxylic acid |
| SMILES | CC1CCN(C(=O)C(C)S(C)(=O)=O)C1C(=O)O |
| InChI | InChI=1S/C10H17NO5S/c1-6-4-5-11(8(6)10(13)14)9(12)7(2)17(3,15)16/h6-8H,4-5H2,1-3H3,(H,13,14) |
| InChIKey | JCFNZVALBOLDIB-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.31 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |