C15H26N2OS — CID 102777725
[1-[2-amino-1-(3-methylthiophen-2-yl)butyl]-3-methylpyrrolidin-2-yl]methanol (PubChem CID 102777725) has the molecular formula C15H26N2OS and a molecular weight of 282.45 g/mol. Its IUPAC name is [1-[2-amino-1-(3-methylthiophen-2-yl)butyl]-3-methylpyrrolidin-2-yl]methanol.
| Compound Name | [1-[2-amino-1-(3-methylthiophen-2-yl)butyl]-3-methylpyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 102777725 |
| Molecular Formula | C15H26N2OS |
| Molecular Weight | 282.45 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | [1-[2-amino-1-(3-methylthiophen-2-yl)butyl]-3-methylpyrrolidin-2-yl]methanol |
| SMILES | CCC(N)C(c1sccc1C)N1CCC(C)C1CO |
| InChI | InChI=1S/C15H26N2OS/c1-4-12(16)14(15-11(3)6-8-19-15)17-7-5-10(2)13(17)9-18/h6,8,10,12-14,18H,4-5,7,9,16H2,1-3H3 |
| InChIKey | BIFMMUPERCGZEJ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.45 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |