C14H26N2O3 — CID 102778708
ethyl 2-[2-methylpropyl-(3-methylpyrrolidine-2-carbonyl)amino]acetate (PubChem CID 102778708) has the molecular formula C14H26N2O3 and a molecular weight of 270.37 g/mol. Its IUPAC name is ethyl 2-[2-methylpropyl-(3-methylpyrrolidine-2-carbonyl)amino]acetate.
| Compound Name | ethyl 2-[2-methylpropyl-(3-methylpyrrolidine-2-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 102778708 |
| Molecular Formula | C14H26N2O3 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | ethyl 2-[2-methylpropyl-(3-methylpyrrolidine-2-carbonyl)amino]acetate |
| SMILES | CCOC(=O)CN(CC(C)C)C(=O)C1NCCC1C |
| InChI | InChI=1S/C14H26N2O3/c1-5-19-12(17)9-16(8-10(2)3)14(18)13-11(4)6-7-15-13/h10-11,13,15H,5-9H2,1-4H3 |
| InChIKey | VZDMHXFYNLLFSW-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |