C22H22Cl3NOS2 — CID 10277892
3-[(16,17-dichloro-3,13-dithiatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),4,7,9,11,14,16-octaen-4-yl)methoxy]-N,N-dimethylpropan-1-amine;hydrochloride (PubChem CID 10277892) has the molecular formula C22H22Cl3NOS2 and a molecular weight of 486.92 g/mol. Its IUPAC name is 3-[(16,17-dichloro-3,13-dithiatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),4,7,9,11,14,16-octaen-4-yl)methoxy]-N,N-dimethylpropan-1-amine;hydrochloride.
| Compound Name | 3-[(16,17-dichloro-3,13-dithiatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),4,7,9,11,14,16-octaen-4-yl)methoxy]-N,N-dimethylpropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 10277892 |
| Molecular Formula | C22H22Cl3NOS2 |
| Molecular Weight | 486.92 g/mol |
| Exact Mass | 485.02 |
| IUPAC Name | 3-[(16,17-dichloro-3,13-dithiatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),4,7,9,11,14,16-octaen-4-yl)methoxy]-N,N-dimethylpropan-1-amine;hydrochloride |
| SMILES | CN(C)CCCOCc1cc2c(s1)-c1cc(Cl)c(Cl)cc1Sc1ccccc1-2.Cl |
| InChI | InChI=1S/C22H21Cl2NOS2.ClH/c1-25(2)8-5-9-26-13-14-10-16-15-6-3-4-7-20(15)28-21-12-19(24)18(23)11-17(21)22(16)27-14;/h3-4,6-7,10-12H,5,8-9,13H2,1-2H3;1H |
| InChIKey | SSBSRYUWTGXPCG-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.92 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|