C21H21N5O5S2 — CID 10277921
N-hydroxy-4-[(4-methoxyphenyl)sulfonylmethyl-thiophen-3-ylamino]-1,3-dimethylpyrazolo[3,4-b]pyridine-5-carboxamide (PubChem CID 10277921) has the molecular formula C21H21N5O5S2 and a molecular weight of 487.56 g/mol. Its IUPAC name is N-hydroxy-4-[(4-methoxyphenyl)sulfonylmethyl-thiophen-3-ylamino]-1,3-dimethylpyrazolo[3,4-b]pyridine-5-carboxamide.
| Compound Name | N-hydroxy-4-[(4-methoxyphenyl)sulfonylmethyl-thiophen-3-ylamino]-1,3-dimethylpyrazolo[3,4-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 10277921 |
| Molecular Formula | C21H21N5O5S2 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.10 |
| IUPAC Name | N-hydroxy-4-[(4-methoxyphenyl)sulfonylmethyl-thiophen-3-ylamino]-1,3-dimethylpyrazolo[3,4-b]pyridine-5-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)CN(c2ccsc2)c2c(C(=O)NO)cnc3c2c(C)nn3C)cc1 |
| InChI | InChI=1S/C21H21N5O5S2/c1-13-18-19(17(21(27)24-28)10-22-20(18)25(2)23-13)26(14-8-9-32-11-14)12-33(29,30)16-6-4-15(31-3)5-7-16/h4-11,28H,12H2,1-3H3,(H,24,27) |
| InChIKey | DZYRJQBLUURRMR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|