About N-(3,5-dimethylphenyl)-N,3-dimethylpyrrolidine-2-carboxamide
N-(3,5-dimethylphenyl)-N,3-dimethylpyrrolidine-2-carboxamide (PubChem CID 102779294) has the molecular formula C15H22N2O
and a molecular weight of 246.35 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-N,3-dimethylpyrrolidine-2-carboxamide.
Molecular Properties
| Compound Name | N-(3,5-dimethylphenyl)-N,3-dimethylpyrrolidine-2-carboxamide |
| PubChem CID | 102779294 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | N-(3,5-dimethylphenyl)-N,3-dimethylpyrrolidine-2-carboxamide |
| SMILES | Cc1cc(C)cc(N(C)C(=O)C2NCCC2C)c1 |
| InChI | InChI=1S/C15H22N2O/c1-10-7-11(2)9-13(8-10)17(4)15(18)14-12(3)5-6-16-14/h7-9,12,14,16H,5-6H2,1-4H3 |
| InChIKey | BMLRRIHDJFSPER-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(3,5-dimethylphenyl)-N,3-dimethylpyrrolidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,5-dimethylphenyl)-N,3-dimethylpyrrolidine-2-carboxamide?
The IUPAC name of N-(3,5-dimethylphenyl)-N,3-dimethylpyrrolidine-2-carboxamide (CID 102779294) is N-(3,5-dimethylphenyl)-N,3-dimethylpyrrolidine-2-carboxamide.
What is the SMILES notation for N-(3,5-dimethylphenyl)-N,3-dimethylpyrrolidine-2-carboxamide?
The canonical SMILES for N-(3,5-dimethylphenyl)-N,3-dimethylpyrrolidine-2-carboxamide is Cc1cc(C)cc(N(C)C(=O)C2NCCC2C)c1.
What is the InChIKey of N-(3,5-dimethylphenyl)-N,3-dimethylpyrrolidine-2-carboxamide?
The InChIKey is BMLRRIHDJFSPER-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O/c1-10-7-11(2)9-13(8-10)17(4)15(18)14-12(3)5-6-16-14/h7-9,12,14,16H,5-6H2,1-4H3.
What are the key properties of N-(3,5-dimethylphenyl)-N,3-dimethylpyrrolidine-2-carboxamide?
N-(3,5-dimethylphenyl)-N,3-dimethylpyrrolidine-2-carboxamide has a molecular weight of 246.35 g/mol, XLogP of 2.26, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,5-dimethylphenyl)-N,3-dimethylpyrrolidine-2-carboxamide is sourced from PubChem (CID 102779294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).