C26H44N6O3 — CID 10277999
ethyl N-[C-(azepan-1-yl)-N-[(2S)-1-[(4-cyano-1-methylpiperidin-4-yl)amino]-3-cyclohexyl-1-oxopropan-2-yl]carbonimidoyl]carbamate (PubChem CID 10277999) has the molecular formula C26H44N6O3 and a molecular weight of 488.68 g/mol. Its IUPAC name is ethyl N-[C-(azepan-1-yl)-N-[(2S)-1-[(4-cyano-1-methylpiperidin-4-yl)amino]-3-cyclohexyl-1-oxopropan-2-yl]carbonimidoyl]carbamate.
| Compound Name | ethyl N-[C-(azepan-1-yl)-N-[(2S)-1-[(4-cyano-1-methylpiperidin-4-yl)amino]-3-cyclohexyl-1-oxopropan-2-yl]carbonimidoyl]carbamate |
|---|---|
| PubChem CID | 10277999 |
| Molecular Formula | C26H44N6O3 |
| Molecular Weight | 488.68 g/mol |
| Exact Mass | 488.35 |
| IUPAC Name | ethyl N-[C-(azepan-1-yl)-N-[(2S)-1-[(4-cyano-1-methylpiperidin-4-yl)amino]-3-cyclohexyl-1-oxopropan-2-yl]carbonimidoyl]carbamate |
| SMILES | CCOC(=O)N/C(=N\[C@@H](CC1CCCCC1)C(=O)NC1(C#N)CCN(C)CC1)N1CCCCCC1 |
| InChI | InChI=1S/C26H44N6O3/c1-3-35-25(34)29-24(32-15-9-4-5-10-16-32)28-22(19-21-11-7-6-8-12-21)23(33)30-26(20-27)13-17-31(2)18-14-26/h21-22H,3-19H2,1-2H3,(H,30,33)(H,28,29,34)/t22-/m0/s1 |
| InChIKey | ZKNFOWFRKCRWJU-QFIPXVFZSA-N |
| XLogP | 3.41 |
| TPSA | 110.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.68 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|