C22H18ClIN2O — CID 10278005
5-chloro-11-methoxy-8,20-dimethyl-8-aza-20-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(20),2(7),3,5,9,11,13(21),14,16,18-decaene iodide (PubChem CID 10278005) has the molecular formula C22H18ClIN2O and a molecular weight of 488.76 g/mol. Its IUPAC name is 5-chloro-11-methoxy-8,20-dimethyl-8-aza-20-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(20),2(7),3,5,9,11,13(21),14,16,18-decaene iodide.
| Compound Name | 5-chloro-11-methoxy-8,20-dimethyl-8-aza-20-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(20),2(7),3,5,9,11,13(21),14,16,18-decaene iodide |
|---|---|
| PubChem CID | 10278005 |
| Molecular Formula | C22H18ClIN2O |
| Molecular Weight | 488.76 g/mol |
| Exact Mass | 488.02 |
| IUPAC Name | 5-chloro-11-methoxy-8,20-dimethyl-8-aza-20-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(20),2(7),3,5,9,11,13(21),14,16,18-decaene iodide |
| SMILES | COc1cc2c3c([n+](C)c4ccccc4c3c1)-c1ccc(Cl)cc1N2C.[I-] |
| InChI | InChI=1S/C22H18ClN2O.HI/c1-24-19-10-13(23)8-9-16(19)22-21-17(11-14(26-3)12-20(21)24)15-6-4-5-7-18(15)25(22)2;/h4-12H,1-3H3;1H/q+1;/p-1 |
| InChIKey | LHCPUPWGHFWPFH-UHFFFAOYSA-M |
| XLogP | 2.23 |
| TPSA | 16.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.76 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|